Urolithin B (1139-83-9 factory Onye nrụpụta ụlọ ọrụ

Urolithin B

November 9, 2020

Urolithin BSmmezi

aha: Urolithin B
Chemical aha: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-otu
CAS: 1139-83-9
Usoro Chemical: C13H8O3
Ọbara arọ: 212.2 g / mol
agba:  White ntụ ntụ
InChi Igodo: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Koodu SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ọrụ: Urolithin B nwere ike melite ọrụ mitochondrial na akwara.

Urolithin B nwere ike imeziwanye ike na ntachi obi n’oge ịka nká.

ngwa: Urolithin B bụ metabolite microbial metabolic nke ellagitannis ma gosipụta ikike mgbochi oxidant na pro-oxidant na-adabere na sistemụ na ọnọdụ. Urolithin B nwekwara ike igosipụta estrogenic na / ma ọ bụ ọrụ mgbochi estrogenic.
Solubility: Na mfe soluble na N, N-dimethylformamide na dimethylmethylene. Sulfone, nke nwere ntakịrị mmiri na methanol, ethanol, na acylate ethyl
Nchekwa Nche: Hygroscopic, -20 Celsius C Freezer, N'okpuru ọnọdụ ikuku
Ọnọdụ Mbupu: Ebubo n'okpuru okpomọkụ dị jụụ dị ka chemical na-adịghị ize ndụ. Ngwaahịa a zuru oke maka izu ole na ole n'oge njem nkịtị na oge ejiri mee ihe na Omenala.